C42H41N3O4 — CID 126302706
3-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126302706) has the molecular formula C42H41N3O4 and a molecular weight of 651.81 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126302706 |
| Molecular Formula | C42H41N3O4 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 3-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C42H41N3O4/c1-7-14-31-22-29(23-39(48-8-2)40(31)49-26-32-17-13-16-30-15-9-10-18-33(30)32)25-43-45-41(44-37-20-12-11-19-34(37)42(45)46)36-24-35(27(3)4)38(47-6)21-28(36)5/h7,9-13,15-25,27H,1,8,14,26H2,2-6H3 |
| InChIKey | IGGRNDHHDGMDOP-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|