C38H37Cl2N3O4 — CID 126294593
3-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126294593) has the molecular formula C38H37Cl2N3O4 and a molecular weight of 670.64 g/mol. Its IUPAC name is 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126294593 |
| Molecular Formula | C38H37Cl2N3O4 |
| Molecular Weight | 670.64 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C38H37Cl2N3O4/c1-7-11-26-17-25(18-35(46-8-2)36(26)47-22-27-14-15-28(39)19-32(27)40)21-41-43-37(42-33-13-10-9-12-29(33)38(43)44)31-20-30(23(3)4)34(45-6)16-24(31)5/h7,9-10,12-21,23H,1,8,11,22H2,2-6H3 |
| InChIKey | HJSKROBQYCVXOP-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.64 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|