C38H38FN3O4 — CID 126294846
3-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126294846) has the molecular formula C38H38FN3O4 and a molecular weight of 619.74 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126294846 |
| Molecular Formula | C38H38FN3O4 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 3-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc(OCC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C38H38FN3O4/c1-7-11-28-19-27(20-35(45-8-2)36(28)46-23-26-14-16-29(39)17-15-26)22-40-42-37(41-33-13-10-9-12-30(33)38(42)43)32-21-31(24(3)4)34(44-6)18-25(32)5/h7,9-10,12-22,24H,1,8,11,23H2,2-6H3 |
| InChIKey | BLEAXLVPPWUTCK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|