C39H39FN4O5 — CID 126301965
2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126301965) has the molecular formula C39H39FN4O5 and a molecular weight of 662.76 g/mol. Its IUPAC name is 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126301965 |
| Molecular Formula | C39H39FN4O5 |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OCC)cc3C)nc3ccccc3c2=O)cc(OC)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C39H39FN4O5/c1-7-11-27-19-26(20-35(47-6)37(27)49-23-36(45)42-29-16-14-28(40)15-17-29)22-41-44-38(43-33-13-10-9-12-30(33)39(44)46)32-21-31(24(3)4)34(48-8-2)18-25(32)5/h7,9-10,12-22,24H,1,8,11,23H2,2-6H3,(H,42,45) |
| InChIKey | RNQIHNZDMOQGQH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|