C33H28FI2N3O3 — CID 126297513
3-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126297513) has the molecular formula C33H28FI2N3O3 and a molecular weight of 787.41 g/mol. Its IUPAC name is 3-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126297513 |
| Molecular Formula | C33H28FI2N3O3 |
| Molecular Weight | 787.41 g/mol |
| Exact Mass | 787.02 |
| IUPAC Name | 3-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(OCc3ccc(F)cc3)c(I)c2)cc1C(C)C |
| InChI | InChI=1S/C33H28FI2N3O3/c1-19(2)25-16-26(20(3)13-30(25)41-4)32-38-29-8-6-5-7-24(29)33(40)39(32)37-17-22-14-27(35)31(28(36)15-22)42-18-21-9-11-23(34)12-10-21/h5-17,19H,18H2,1-4H3 |
| InChIKey | BALXBMRZTJNIIJ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.41 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|