C29H29I2N3O3 — CID 126288179
3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126288179) has the molecular formula C29H29I2N3O3 and a molecular weight of 721.38 g/mol. Its IUPAC name is 3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126288179 |
| Molecular Formula | C29H29I2N3O3 |
| Molecular Weight | 721.38 g/mol |
| Exact Mass | 721.03 |
| IUPAC Name | 3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(OCC)c(I)c2)cc1C(C)C |
| InChI | InChI=1S/C29H29I2N3O3/c1-6-36-26-12-18(5)22(15-21(26)17(3)4)28-33-25-11-9-8-10-20(25)29(35)34(28)32-16-19-13-23(30)27(37-7-2)24(31)14-19/h8-17H,6-7H2,1-5H3 |
| InChIKey | FWMTYIPNYWNAQO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.38 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|