C32H36IN3O4 — CID 126307629
3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126307629) has the molecular formula C32H36IN3O4 and a molecular weight of 653.56 g/mol. Its IUPAC name is 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126307629 |
| Molecular Formula | C32H36IN3O4 |
| Molecular Weight | 653.56 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc(I)c1O[C@H](C)CC |
| InChI | InChI=1S/C32H36IN3O4/c1-8-21(6)40-30-26(33)15-22(16-29(30)39-9-2)18-34-36-31(35-27-13-11-10-12-23(27)32(36)37)25-17-24(19(3)4)28(38-7)14-20(25)5/h10-19,21H,8-9H2,1-7H3/t21-/m1/s1 |
| InChIKey | CKMPSZQAARVDEY-OAQYLSRUSA-N |
| XLogP | 7.57 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.56 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|