C28H25I2N3O5 — CID 126280140
2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 126280140) has the molecular formula C28H25I2N3O5 and a molecular weight of 737.33 g/mol. Its IUPAC name is 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126280140 |
| Molecular Formula | C28H25I2N3O5 |
| Molecular Weight | 737.33 g/mol |
| Exact Mass | 736.99 |
| IUPAC Name | 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(OCC(=O)O)c(I)c2)cc1C(C)C |
| InChI | InChI=1S/C28H25I2N3O5/c1-15(2)19-12-20(16(3)9-24(19)37-4)27-32-23-8-6-5-7-18(23)28(36)33(27)31-13-17-10-21(29)26(22(30)11-17)38-14-25(34)35/h5-13,15H,14H2,1-4H3,(H,34,35) |
| InChIKey | AZQNJCJIPPXYLS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.33 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|