C27H26IN3O4 — CID 137068183
3-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 137068183) has the molecular formula C27H26IN3O4 and a molecular weight of 583.43 g/mol. Its IUPAC name is 3-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137068183 |
| Molecular Formula | C27H26IN3O4 |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | 3-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(O)c(OC)c2)cc1C(C)C |
| InChI | InChI=1S/C27H26IN3O4/c1-15(2)19-13-20(16(3)10-23(19)34-4)26-30-22-9-7-6-8-18(22)27(33)31(26)29-14-17-11-21(28)25(32)24(12-17)35-5/h6-15,32H,1-5H3 |
| InChIKey | SUBAOUNCWABFEO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|