C29H27I2N3O5 — CID 126297147
methyl 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate (PubChem CID 126297147) has the molecular formula C29H27I2N3O5 and a molecular weight of 751.36 g/mol. Its IUPAC name is methyl 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126297147 |
| Molecular Formula | C29H27I2N3O5 |
| Molecular Weight | 751.36 g/mol |
| Exact Mass | 751.00 |
| IUPAC Name | methyl 2-[2,6-diiodo-4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C29H27I2N3O5/c1-16(2)20-13-21(17(3)10-25(20)37-4)28-33-24-9-7-6-8-19(24)29(36)34(28)32-14-18-11-22(30)27(23(31)12-18)39-15-26(35)38-5/h6-14,16H,15H2,1-5H3 |
| InChIKey | OCHZBVGRBQTSKY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|