C31H32IN3O5 — CID 126306681
ethyl 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetate (PubChem CID 126306681) has the molecular formula C31H32IN3O5 and a molecular weight of 653.52 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126306681 |
| Molecular Formula | C31H32IN3O5 |
| Molecular Weight | 653.52 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | ethyl 2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=Nn2c(-c3cc(C(C)C)c(OCC)cc3C)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C31H32IN3O5/c1-6-38-28-14-20(5)24(16-23(28)19(3)4)30-34-26-11-9-8-10-22(26)31(37)35(30)33-17-21-12-13-27(25(32)15-21)40-18-29(36)39-7-2/h8-17,19H,6-7,18H2,1-5H3 |
| InChIKey | ZLQBFAXOYBWXLP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|