C29H29ClN4O4 — CID 126312517
2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide (PubChem CID 126312517) has the molecular formula C29H29ClN4O4 and a molecular weight of 533.03 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126312517 |
| Molecular Formula | C29H29ClN4O4 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Cl)ccc2OCC(N)=O)cc1C(C)C |
| InChI | InChI=1S/C29H29ClN4O4/c1-5-37-26-12-18(4)23(14-22(26)17(2)3)28-33-24-9-7-6-8-21(24)29(36)34(28)32-15-19-13-20(30)10-11-25(19)38-16-27(31)35/h6-15,17H,5,16H2,1-4H3,(H2,31,35) |
| InChIKey | PPTVZFCFLWKCSN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|