C34H30BrI2N3O3 — CID 126291238
3-[[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126291238) has the molecular formula C34H30BrI2N3O3 and a molecular weight of 862.34 g/mol. Its IUPAC name is 3-[[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126291238 |
| Molecular Formula | C34H30BrI2N3O3 |
| Molecular Weight | 862.34 g/mol |
| Exact Mass | 860.96 |
| IUPAC Name | 3-[[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(OCc3ccc(Br)cc3)c(I)c2)cc1C(C)C |
| InChI | InChI=1S/C34H30BrI2N3O3/c1-5-42-31-14-21(4)27(17-26(31)20(2)3)33-39-30-9-7-6-8-25(30)34(41)40(33)38-18-23-15-28(36)32(29(37)16-23)43-19-22-10-12-24(35)13-11-22/h6-18,20H,5,19H2,1-4H3 |
| InChIKey | WADISZVDTLZKBF-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.34 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|