C34H39N3O4 — CID 126281522
3-[[4-[(2S)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126281522) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-[[4-[(2S)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2S)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126281522 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 3-[[4-[(2S)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc(OC)c1O[C@@H](C)CC |
| InChI | InChI=1S/C34H39N3O4/c1-9-13-25-17-24(18-31(40-8)32(25)41-23(6)10-2)20-35-37-33(36-29-15-12-11-14-26(29)34(37)38)28-19-27(21(3)4)30(39-7)16-22(28)5/h9,11-12,14-21,23H,1,10,13H2,2-8H3/t23-/m0/s1 |
| InChIKey | IUIYNRIPLKKXLS-QHCPKHFHSA-N |
| XLogP | 7.30 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|