C37H32N4O5 — CID 126290303
2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-3-[[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126290303) has the molecular formula C37H32N4O5 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-3-[[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-3-[[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126290303 |
| Molecular Formula | C37H32N4O5 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-3-[[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cccc([N+](=O)[O-])c2OCc2cccc3ccccc23)cc1C(C)C |
| InChI | InChI=1S/C37H32N4O5/c1-23(2)30-20-31(24(3)19-34(30)45-4)36-39-32-17-8-7-16-29(32)37(42)40(36)38-21-26-13-10-18-33(41(43)44)35(26)46-22-27-14-9-12-25-11-5-6-15-28(25)27/h5-21,23H,22H2,1-4H3 |
| InChIKey | SQCZWWPZIRKYRD-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|