C33H28Cl2N4O5 — CID 126302495
3-[[2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126302495) has the molecular formula C33H28Cl2N4O5 and a molecular weight of 631.52 g/mol. Its IUPAC name is 3-[[2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126302495 |
| Molecular Formula | C33H28Cl2N4O5 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 3-[[2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cccc([N+](=O)[O-])c2OCc2ccc(Cl)c(Cl)c2)cc1C(C)C |
| InChI | InChI=1S/C33H28Cl2N4O5/c1-19(2)24-16-25(20(3)14-30(24)43-4)32-37-28-10-6-5-9-23(28)33(40)38(32)36-17-22-8-7-11-29(39(41)42)31(22)44-18-21-12-13-26(34)27(35)15-21/h5-17,19H,18H2,1-4H3 |
| InChIKey | SZHYKFPZRKUXEB-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|