C34H29BrN4O7 — CID 126304874
3-[[4-bromo-2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126304874) has the molecular formula C34H29BrN4O7 and a molecular weight of 685.53 g/mol. Its IUPAC name is 3-[[4-bromo-2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-bromo-2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126304874 |
| Molecular Formula | C34H29BrN4O7 |
| Molecular Weight | 685.53 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 3-[[4-bromo-2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)cc([N+](=O)[O-])c2OCc2cccc(C(=O)O)c2)cc1C(C)C |
| InChI | InChI=1S/C34H29BrN4O7/c1-19(2)26-16-27(20(3)12-30(26)45-4)32-37-28-11-6-5-10-25(28)33(40)38(32)36-17-23-14-24(35)15-29(39(43)44)31(23)46-18-21-8-7-9-22(13-21)34(41)42/h5-17,19H,18H2,1-4H3,(H,41,42) |
| InChIKey | OAKMPJJDOQSSRJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.53 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|