C34H30BrN5O7 — CID 126308817
3-[[5-bromo-3-nitro-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126308817) has the molecular formula C34H30BrN5O7 and a molecular weight of 700.55 g/mol. Its IUPAC name is 3-[[5-bromo-3-nitro-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[5-bromo-3-nitro-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126308817 |
| Molecular Formula | C34H30BrN5O7 |
| Molecular Weight | 700.55 g/mol |
| Exact Mass | 699.13 |
| IUPAC Name | 3-[[5-bromo-3-nitro-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)cc([N+](=O)[O-])c2OCc2ccc([N+](=O)[O-])cc2)cc1C(C)C |
| InChI | InChI=1S/C34H30BrN5O7/c1-5-46-31-14-21(4)28(17-27(31)20(2)3)33-37-29-9-7-6-8-26(29)34(41)38(33)36-18-23-15-24(35)16-30(40(44)45)32(23)47-19-22-10-12-25(13-11-22)39(42)43/h6-18,20H,5,19H2,1-4H3 |
| InChIKey | DQGKHHKXJRBIKC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 151.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.55 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|