C40H39N5O5 — CID 126300340
3-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126300340) has the molecular formula C40H39N5O5 and a molecular weight of 669.78 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126300340 |
| Molecular Formula | C40H39N5O5 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 3-[[2,5-dimethyl-1-[4-[(4-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3ccc(OCc4ccc([N+](=O)[O-])cc4)cc3)c2C)cc1C(C)C |
| InChI | InChI=1S/C40H39N5O5/c1-7-49-38-20-26(4)36(22-35(38)25(2)3)39-42-37-11-9-8-10-34(37)40(46)44(39)41-23-30-21-27(5)43(28(30)6)31-16-18-33(19-17-31)50-24-29-12-14-32(15-13-29)45(47)48/h8-23,25H,7,24H2,1-6H3 |
| InChIKey | LQFMZKOJBKVBNV-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 113.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|