C34H36N4O3 — CID 126313360
2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126313360) has the molecular formula C34H36N4O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126313360 |
| Molecular Formula | C34H36N4O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3cccc(OC)c3)c2C)cc1C(C)C |
| InChI | InChI=1S/C34H36N4O3/c1-8-41-32-16-22(4)30(19-29(32)21(2)3)33-36-31-15-10-9-14-28(31)34(39)38(33)35-20-25-17-23(5)37(24(25)6)26-12-11-13-27(18-26)40-7/h9-21H,8H2,1-7H3 |
| InChIKey | ROYSFFPQZJZQJL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|