C36H38N4O5 — CID 126285098
(2S)-2-[4-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]propanoic acid (PubChem CID 126285098) has the molecular formula C36H38N4O5 and a molecular weight of 606.72 g/mol. Its IUPAC name is (2S)-2-[4-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126285098 |
| Molecular Formula | C36H38N4O5 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (2S)-2-[4-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]propanoic acid |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3ccc(O[C@@H](C)C(=O)O)cc3)c2C)cc1C(C)C |
| InChI | InChI=1S/C36H38N4O5/c1-8-44-33-17-22(4)31(19-30(33)21(2)3)34-38-32-12-10-9-11-29(32)35(41)40(34)37-20-26-18-23(5)39(24(26)6)27-13-15-28(16-14-27)45-25(7)36(42)43/h9-21,25H,8H2,1-7H3,(H,42,43)/t25-/m0/s1 |
| InChIKey | FXJSNYXJFZHAGH-VWLOTQADSA-N |
| XLogP | 7.04 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|