C31H31N5O2 — CID 126298751
3-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126298751) has the molecular formula C31H31N5O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 3-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126298751 |
| Molecular Formula | C31H31N5O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3ccccn3)c2C)cc1C(C)C |
| InChI | InChI=1S/C31H31N5O2/c1-19(2)25-17-26(20(3)15-28(25)38-6)30-34-27-12-8-7-11-24(27)31(37)36(30)33-18-23-16-21(4)35(22(23)5)29-13-9-10-14-32-29/h7-19H,1-6H3 |
| InChIKey | FCUVDCXNMMDTTF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|