C34H35IN4O2 — CID 126306134
2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126306134) has the molecular formula C34H35IN4O2 and a molecular weight of 658.58 g/mol. Its IUPAC name is 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126306134 |
| Molecular Formula | C34H35IN4O2 |
| Molecular Weight | 658.58 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-3-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3ccc(I)c(C)c3)c2C)cc1C(C)C |
| InChI | InChI=1S/C34H35IN4O2/c1-8-41-32-16-21(4)29(18-28(32)20(2)3)33-37-31-12-10-9-11-27(31)34(40)39(33)36-19-25-17-23(6)38(24(25)7)26-13-14-30(35)22(5)15-26/h9-20H,8H2,1-7H3 |
| InChIKey | SYLIHNQPCHUWPC-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.58 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|