C31H25F3N4O4 — CID 126291921
(2R)-2-[4-[2,5-dimethyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]pyrrol-1-yl]phenoxy]propanoic acid (PubChem CID 126291921) has the molecular formula C31H25F3N4O4 and a molecular weight of 574.56 g/mol. Its IUPAC name is (2R)-2-[4-[2,5-dimethyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]pyrrol-1-yl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[2,5-dimethyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]pyrrol-1-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126291921 |
| Molecular Formula | C31H25F3N4O4 |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | (2R)-2-[4-[2,5-dimethyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]pyrrol-1-yl]phenoxy]propanoic acid |
| SMILES | Cc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c(C)n1-c1ccc(O[C@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C31H25F3N4O4/c1-18-15-22(19(2)37(18)24-11-13-25(14-12-24)42-20(3)30(40)41)17-35-38-28(21-7-6-8-23(16-21)31(32,33)34)36-27-10-5-4-9-26(27)29(38)39/h4-17,20H,1-3H3,(H,40,41)/t20-/m1/s1 |
| InChIKey | OFGAVUYBXSXBAM-HXUWFJFHSA-N |
| XLogP | 6.22 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|