C33H23F3N6O4 — CID 126292274
3-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126292274) has the molecular formula C33H23F3N6O4 and a molecular weight of 624.58 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126292274 |
| Molecular Formula | C33H23F3N6O4 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 3-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c(C)n1-c1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C33H23F3N6O4/c1-20-16-23(21(2)40(20)25-10-13-27(14-11-25)46-30-15-12-26(19-37-30)42(44)45)18-38-41-31(22-6-5-7-24(17-22)33(34,35)36)39-29-9-4-3-8-28(29)32(41)43/h3-19H,1-2H3 |
| InChIKey | VRSVJVGRCNXZGN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|