C35H26F4N4O2 — CID 126295516
3-[[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126295516) has the molecular formula C35H26F4N4O2 and a molecular weight of 610.61 g/mol. Its IUPAC name is 3-[[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126295516 |
| Molecular Formula | C35H26F4N4O2 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 3-[[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c(C)n1-c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C35H26F4N4O2/c1-22-18-26(23(2)42(22)28-14-16-29(17-15-28)45-21-25-8-3-5-12-31(25)36)20-40-43-33(24-9-7-10-27(19-24)35(37,38)39)41-32-13-6-4-11-30(32)34(43)44/h3-20H,21H2,1-2H3 |
| InChIKey | GBNVYDRXGYXKFZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|