C28H21F3N4O2 — CID 126294197
3-[[1-(4-ethoxyphenyl)pyrrol-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126294197) has the molecular formula C28H21F3N4O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is 3-[[1-(4-ethoxyphenyl)pyrrol-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[1-(4-ethoxyphenyl)pyrrol-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126294197 |
| Molecular Formula | C28H21F3N4O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 3-[[1-(4-ethoxyphenyl)pyrrol-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCOc1ccc(-n2cccc2C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H21F3N4O2/c1-2-37-23-14-12-21(13-15-23)34-16-6-9-22(34)18-32-35-26(19-7-5-8-20(17-19)28(29,30)31)33-25-11-4-3-10-24(25)27(35)36/h3-18H,2H2,1H3 |
| InChIKey | CBSDDXFHWNOKSZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|