C21H14F3N3O2 — CID 126288265
3-[(3-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126288265) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 3-[(3-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(3-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126288265 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-[(3-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | Cc1ccoc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H14F3N3O2/c1-13-9-10-29-18(13)12-25-27-19(14-5-4-6-15(11-14)21(22,23)24)26-17-8-3-2-7-16(17)20(27)28/h2-12H,1H3 |
| InChIKey | GCOFWHYEGDXWIJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|