C26H19F3N4O — CID 126290786
3-[(1-ethylindol-3-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126290786) has the molecular formula C26H19F3N4O and a molecular weight of 460.46 g/mol. Its IUPAC name is 3-[(1-ethylindol-3-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(1-ethylindol-3-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126290786 |
| Molecular Formula | C26H19F3N4O |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 3-[(1-ethylindol-3-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCn1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C26H19F3N4O/c1-2-32-16-18(20-10-4-6-13-23(20)32)15-30-33-24(17-8-7-9-19(14-17)26(27,28)29)31-22-12-5-3-11-21(22)25(33)34/h3-16H,2H2,1H3 |
| InChIKey | VCZZKVBUTBZKGQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|