C32H22F3N5O2 — CID 126303562
2-[3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]-N-phenylacetamide (PubChem CID 126303562) has the molecular formula C32H22F3N5O2 and a molecular weight of 565.56 g/mol. Its IUPAC name is 2-[3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 126303562 |
| Molecular Formula | C32H22F3N5O2 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 2-[3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C32H22F3N5O2/c33-32(34,35)23-10-8-9-21(17-23)30-38-27-15-6-4-14-26(27)31(42)40(30)36-18-22-19-39(28-16-7-5-13-25(22)28)20-29(41)37-24-11-2-1-3-12-24/h1-19H,20H2,(H,37,41) |
| InChIKey | LAGWQQVIZSGVLI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|