C28H23F3N4O — CID 126292444
3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126292444) has the molecular formula C28H23F3N4O and a molecular weight of 488.51 g/mol. Its IUPAC name is 3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126292444 |
| Molecular Formula | C28H23F3N4O |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CC[C@H](C)n1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C28H23F3N4O/c1-3-18(2)34-17-20(22-11-5-7-14-25(22)34)16-32-35-26(19-9-8-10-21(15-19)28(29,30)31)33-24-13-6-4-12-23(24)27(35)36/h4-18H,3H2,1-2H3/t18-/m0/s1 |
| InChIKey | YGLOAJJQMUWDCJ-SFHVURJKSA-N |
| XLogP | 6.89 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|