C29H24N4O2 — CID 126302856
2-(1-benzofuran-2-yl)-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126302856) has the molecular formula C29H24N4O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126302856 |
| Molecular Formula | C29H24N4O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[1-[(2S)-butan-2-yl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)n1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C29H24N4O2/c1-3-19(2)32-18-21(22-11-6-8-14-25(22)32)17-30-33-28(27-16-20-10-4-9-15-26(20)35-27)31-24-13-7-5-12-23(24)29(33)34/h4-19H,3H2,1-2H3/t19-/m0/s1 |
| InChIKey | IQFZAOLLFOFPQW-IBGZPJMESA-N |
| XLogP | 6.62 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|