C25H19N3O3 — CID 126293380
2-(1-benzofuran-2-yl)-3-[(4-methoxy-2-methylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126293380) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(4-methoxy-2-methylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(4-methoxy-2-methylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126293380 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(4-methoxy-2-methylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1ccc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C25H19N3O3/c1-16-13-19(30-2)12-11-18(16)15-26-28-24(23-14-17-7-3-6-10-22(17)31-23)27-21-9-5-4-8-20(21)25(28)29/h3-15H,1-2H3 |
| InChIKey | ZIZSLAHOYRNWNF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|