C22H15N3O3 — CID 126311906
2-(1-benzofuran-2-yl)-3-[(5-methylfuran-2-yl)methylideneamino]quinazolin-4-one (PubChem CID 126311906) has the molecular formula C22H15N3O3 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(5-methylfuran-2-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(5-methylfuran-2-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126311906 |
| Molecular Formula | C22H15N3O3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(5-methylfuran-2-yl)methylideneamino]quinazolin-4-one |
| SMILES | Cc1ccc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)o1 |
| InChI | InChI=1S/C22H15N3O3/c1-14-10-11-16(27-14)13-23-25-21(20-12-15-6-2-5-9-19(15)28-20)24-18-8-4-3-7-17(18)22(25)26/h2-13H,1H3 |
| InChIKey | NUTBMASKPXJBAF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|