C21H10Br3N3O3 — CID 126284159
2-(5-bromo-1-benzofuran-2-yl)-3-[(4,5-dibromofuran-2-yl)methylideneamino]quinazolin-4-one (PubChem CID 126284159) has the molecular formula C21H10Br3N3O3 and a molecular weight of 592.04 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(4,5-dibromofuran-2-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(4,5-dibromofuran-2-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126284159 |
| Molecular Formula | C21H10Br3N3O3 |
| Molecular Weight | 592.04 g/mol |
| Exact Mass | 588.83 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(4,5-dibromofuran-2-yl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C21H10Br3N3O3/c22-12-5-6-17-11(7-12)8-18(30-17)20-26-16-4-2-1-3-14(16)21(28)27(20)25-10-13-9-15(23)19(24)29-13/h1-10H |
| InChIKey | CJYVPHUAABTEQY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.04 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|