C28H17BrClN3O3 — CID 126301905
2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126301905) has the molecular formula C28H17BrClN3O3 and a molecular weight of 558.82 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126301905 |
| Molecular Formula | C28H17BrClN3O3 |
| Molecular Weight | 558.82 g/mol |
| Exact Mass | 557.01 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1c(Cl)cccc1-c1ccc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)o1 |
| InChI | InChI=1S/C28H17BrClN3O3/c1-16-20(6-4-7-22(16)30)25-12-10-19(35-25)15-31-33-27(32-23-8-3-2-5-21(23)28(33)34)26-14-17-13-18(29)9-11-24(17)36-26/h2-15H,1H3 |
| InChIKey | FZZIABWYFDADPJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.82 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|