C28H18BrN3O3S — CID 126286727
2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126286727) has the molecular formula C28H18BrN3O3S and a molecular weight of 556.44 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126286727 |
| Molecular Formula | C28H18BrN3O3S |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1ccc(Sc2ccc(C=Nn3c(-c4cc5cc(Br)ccc5o4)nc4ccccc4c3=O)o2)cc1 |
| InChI | InChI=1S/C28H18BrN3O3S/c1-17-6-10-21(11-7-17)36-26-13-9-20(34-26)16-30-32-27(31-23-5-3-2-4-22(23)28(32)33)25-15-18-14-19(29)8-12-24(18)35-25/h2-16H,1H3 |
| InChIKey | JLGJKRUOCUEXNR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|