C28H20N4O2 — CID 126286768
2-(1-benzofuran-2-yl)-3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126286768) has the molecular formula C28H20N4O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126286768 |
| Molecular Formula | C28H20N4O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(-n2cccc2C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C28H20N4O2/c1-19-8-6-10-21(16-19)31-15-7-11-22(31)18-29-32-27(26-17-20-9-2-5-14-25(20)34-26)30-24-13-4-3-12-23(24)28(32)33/h2-18H,1H3 |
| InChIKey | BSKVOOYQYMBBKL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|