C28H19BrN4O3 — CID 126314436
2-(5-bromo-1-benzofuran-2-yl)-3-[[1-(4-methoxyphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126314436) has the molecular formula C28H19BrN4O3 and a molecular weight of 539.39 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-(4-methoxyphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-(4-methoxyphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126314436 |
| Molecular Formula | C28H19BrN4O3 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[1-(4-methoxyphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | COc1ccc(-n2cccc2C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H19BrN4O3/c1-35-22-11-9-20(10-12-22)32-14-4-5-21(32)17-30-33-27(31-24-7-3-2-6-23(24)28(33)34)26-16-18-15-19(29)8-13-25(18)36-26/h2-17H,1H3 |
| InChIKey | WXMCPZMHSAVFLR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|