C29H22N4O3 — CID 126294083
2-(4-methoxy-1-benzofuran-2-yl)-3-[[1-(2-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one (PubChem CID 126294083) has the molecular formula C29H22N4O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-(4-methoxy-1-benzofuran-2-yl)-3-[[1-(2-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[[1-(2-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294083 |
| Molecular Formula | C29H22N4O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[[1-(2-methylphenyl)pyrrol-2-yl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cccn3-c3ccccc3C)cc12 |
| InChI | InChI=1S/C29H22N4O3/c1-19-9-3-6-13-24(19)32-16-8-10-20(32)18-30-33-28(31-23-12-5-4-11-21(23)29(33)34)27-17-22-25(35-2)14-7-15-26(22)36-27/h3-18H,1-2H3 |
| InChIKey | ATYLKZKJLIHINB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|