C29H26N4O5 — CID 126291974
2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126291974) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126291974 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methoxy-4-morpholin-4-ylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(N2CCOCC2)ccc1C=Nn1c(-c2cc3c(OC)cccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H26N4O5/c1-35-24-8-5-9-25-22(24)17-27(38-25)28-31-23-7-4-3-6-21(23)29(34)33(28)30-18-19-10-11-20(16-26(19)36-2)32-12-14-37-15-13-32/h3-11,16-18H,12-15H2,1-2H3 |
| InChIKey | XPDBLQHKUALDHZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|