C33H30N4O4 — CID 126286730
3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126286730) has the molecular formula C33H30N4O4 and a molecular weight of 546.63 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126286730 |
| Molecular Formula | C33H30N4O4 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 3-[[2,5-dimethyl-1-(4-propan-2-yloxyphenyl)pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cc(C)n(-c4ccc(OC(C)C)cc4)c3C)cc12 |
| InChI | InChI=1S/C33H30N4O4/c1-20(2)40-25-15-13-24(14-16-25)36-21(3)17-23(22(36)4)19-34-37-32(35-28-10-7-6-9-26(28)33(37)38)31-18-27-29(39-5)11-8-12-30(27)41-31/h6-20H,1-5H3 |
| InChIKey | JLHMJQGEZMUWMH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 83.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|