C36H27N5O5S — CID 126286810
3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126286810) has the molecular formula C36H27N5O5S and a molecular weight of 641.71 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126286810 |
| Molecular Formula | C36H27N5O5S |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | 3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cc(C)n(-c4ccc(Sc5ccc([N+](=O)[O-])cc5)cc4)c3C)cc12 |
| InChI | InChI=1S/C36H27N5O5S/c1-22-19-24(23(2)39(22)25-11-15-27(16-12-25)47-28-17-13-26(14-18-28)41(43)44)21-37-40-35(38-31-8-5-4-7-29(31)36(40)42)34-20-30-32(45-3)9-6-10-33(30)46-34/h4-21H,1-3H3 |
| InChIKey | KSQXKHWGOKVVCS-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 117.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|