C35H25N5O4S — CID 126307704
2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126307704) has the molecular formula C35H25N5O4S and a molecular weight of 611.68 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126307704 |
| Molecular Formula | C35H25N5O4S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(C)n1-c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C35H25N5O4S/c1-22-19-25(23(2)38(22)26-11-15-28(16-12-26)45-29-17-13-27(14-18-29)40(42)43)21-36-39-34(33-20-24-7-3-6-10-32(24)44-33)37-31-9-5-4-8-30(31)35(39)41/h3-21H,1-2H3 |
| InChIKey | BKHQQGCSWITJDF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 108.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|