C31H24N4O4 — CID 126285412
3-[3-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid (PubChem CID 126285412) has the molecular formula C31H24N4O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is 3-[3-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-[3-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 126285412 |
| Molecular Formula | C31H24N4O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 3-[3-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-n1c(C)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C31H24N4O4/c1-18-12-13-22(31(37)38)15-26(18)34-19(2)14-23(20(34)3)17-32-35-29(28-16-21-8-4-7-11-27(21)39-28)33-25-10-6-5-9-24(25)30(35)36/h4-17H,1-3H3,(H,37,38) |
| InChIKey | GNAPBXUGFCLNHA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|