C29H24N4O3 — CID 3483713
4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]-3-methylbenzoic acid (PubChem CID 3483713) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]-3-methylbenzoic acid.
| Compound Name | 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 3483713 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-n1c(C)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C29H24N4O3/c1-18-15-22(29(35)36)13-14-26(18)32-19(2)16-23(20(32)3)17-30-33-27(21-9-5-4-6-10-21)31-25-12-8-7-11-24(25)28(33)34/h4-17H,1-3H3,(H,35,36) |
| InChIKey | DWNDXIPKJGBFMB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|