C30H28N4O — CID 4655579
3-[[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 4655579) has the molecular formula C30H28N4O and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 4655579 |
| Molecular Formula | C30H28N4O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 3-[[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCc1cccc(C)c1-n1c(C)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C30H28N4O/c1-5-23-15-11-12-20(2)28(23)33-21(3)18-25(22(33)4)19-31-34-29(24-13-7-6-8-14-24)32-27-17-10-9-16-26(27)30(34)35/h6-19H,5H2,1-4H3 |
| InChIKey | UVSDCRMQDLBTAN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|