C28H21N5O — CID 3291481
4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]benzonitrile (PubChem CID 3291481) has the molecular formula C28H21N5O and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]benzonitrile.
| Compound Name | 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 3291481 |
| Molecular Formula | C28H21N5O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[2,5-dimethyl-3-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]pyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c(C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H21N5O/c1-19-16-23(20(2)32(19)24-14-12-21(17-29)13-15-24)18-30-33-27(22-8-4-3-5-9-22)31-26-11-7-6-10-25(26)28(33)34/h3-16,18H,1-2H3 |
| InChIKey | FEDCNCQCFYRAKF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|