C23H20N4O4 — CID 5158587
4-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid (PubChem CID 5158587) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 5158587 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-n1c(C)cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c1C |
| InChI | InChI=1S/C23H20N4O4/c1-13-10-16(22(29)30)8-9-20(13)26-14(2)11-17(15(26)3)12-24-27-21(28)18-6-4-5-7-19(18)25-23(27)31/h4-12H,1-3H3,(H,25,31)(H,29,30) |
| InChIKey | YGRABTIOVSMDDP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|