C22H19N5O3 — CID 4212891
N-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 4212891) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 4212891 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O3/c1-14-12-17(15(2)26(14)25-20(28)16-8-4-3-5-9-16)13-23-27-21(29)18-10-6-7-11-19(18)24-22(27)30/h3-13H,1-2H3,(H,24,30)(H,25,28) |
| InChIKey | MYANHDIORNCXJH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|